C34H42N2O2P+ — CID 171770358
2-ethoxy-6,9,9,17,17,20-hexamethyl-13-(2-methylphenyl)-20-aza-6-azonia-2λ5-phosphapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene 2-oxide (PubChem CID 171770358) has the molecular formula C34H42N2O2P+ and a molecular weight of 541.70 g/mol. Its IUPAC name is 2-ethoxy-6,9,9,17,17,20-hexamethyl-13-(2-methylphenyl)-20-aza-6-azonia-2λ5-phosphapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene 2-oxide.
| Compound Name | 2-ethoxy-6,9,9,17,17,20-hexamethyl-13-(2-methylphenyl)-20-aza-6-azonia-2λ5-phosphapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene 2-oxide |
|---|---|
| PubChem CID | 171770358 |
| Molecular Formula | C34H42N2O2P+ |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | 2-ethoxy-6,9,9,17,17,20-hexamethyl-13-(2-methylphenyl)-20-aza-6-azonia-2λ5-phosphapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene 2-oxide |
| SMILES | CCOP1(=O)c2cc3c(cc2C(c2ccccc2C)=c2cc4c(cc21)=[N+](C)CCC4(C)C)C(C)(C)CCN3C |
| InChI | InChI=1S/C34H42N2O2P/c1-9-38-39(37)30-20-28-26(33(3,4)14-16-35(28)7)18-24(30)32(23-13-11-10-12-22(23)2)25-19-27-29(21-31(25)39)36(8)17-15-34(27,5)6/h10-13,18-21H,9,14-17H2,1-8H3/q+1 |
| InChIKey | PTMULHHGKSYQRX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|