C6H13F2N — CID 171774217
N,2-difluoro-N-propan-2-ylpropan-1-amine (PubChem CID 171774217) has the molecular formula C6H13F2N and a molecular weight of 137.17 g/mol. Its IUPAC name is N,2-difluoro-N-propan-2-ylpropan-1-amine.
| Compound Name | N,2-difluoro-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 171774217 |
| Molecular Formula | C6H13F2N |
| Molecular Weight | 137.17 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | N,2-difluoro-N-propan-2-ylpropan-1-amine |
| SMILES | CC(F)CN(F)C(C)C |
| InChI | InChI=1S/C6H13F2N/c1-5(2)9(8)4-6(3)7/h5-6H,4H2,1-3H3 |
| InChIKey | YXPMDANSXOXGPG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|