C15H16FNO3S — CID 171778715
N-(2-hydroxy-2,2-diphenylethyl)-N-methylsulfamoyl fluoride (PubChem CID 171778715) has the molecular formula C15H16FNO3S and a molecular weight of 309.36 g/mol. Its IUPAC name is N-(2-hydroxy-2,2-diphenylethyl)-N-methylsulfamoyl fluoride.
| Compound Name | N-(2-hydroxy-2,2-diphenylethyl)-N-methylsulfamoyl fluoride |
|---|---|
| PubChem CID | 171778715 |
| Molecular Formula | C15H16FNO3S |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-(2-hydroxy-2,2-diphenylethyl)-N-methylsulfamoyl fluoride |
| SMILES | CN(CC(O)(c1ccccc1)c1ccccc1)S(=O)(=O)F |
| InChI | InChI=1S/C15H16FNO3S/c1-17(21(16,19)20)12-15(18,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,18H,12H2,1H3 |
| InChIKey | DVMCCEXVNPQCHK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |