C46H32N4 — CID 171780226
2-[2,3,4-tripyridin-2-yl-5-(1,2,2-triphenylethenyl)phenyl]pyridine (PubChem CID 171780226) has the molecular formula C46H32N4 and a molecular weight of 640.79 g/mol. Its IUPAC name is 2-[2,3,4-tripyridin-2-yl-5-(1,2,2-triphenylethenyl)phenyl]pyridine.
| Compound Name | 2-[2,3,4-tripyridin-2-yl-5-(1,2,2-triphenylethenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 171780226 |
| Molecular Formula | C46H32N4 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | 2-[2,3,4-tripyridin-2-yl-5-(1,2,2-triphenylethenyl)phenyl]pyridine |
| SMILES | c1ccc(C(=C(c2ccccc2)c2cc(-c3ccccn3)c(-c3ccccn3)c(-c3ccccn3)c2-c2ccccn2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H32N4/c1-4-18-33(19-5-1)42(34-20-6-2-7-21-34)43(35-22-8-3-9-23-35)37-32-36(38-24-10-14-28-47-38)44(39-25-11-15-29-48-39)46(41-27-13-17-31-50-41)45(37)40-26-12-16-30-49-40/h1-32H |
| InChIKey | SAJSYRGPRPGKCB-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|