About perchloric acid;2-pyridin-2-ylpyridine
perchloric acid;2-pyridin-2-ylpyridine (PubChem CID 71352928) has the molecular formula C10H9ClN2O4
and a molecular weight of 256.65 g/mol. Its IUPAC name is perchloric acid;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | perchloric acid;2-pyridin-2-ylpyridine |
| PubChem CID | 71352928 |
| Molecular Formula | C10H9ClN2O4 |
| Molecular Weight | 256.65 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | perchloric acid;2-pyridin-2-ylpyridine |
| SMILES | [O-][Cl+3]([O-])([O-])O.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.ClHO4/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2-1(3,4)5/h1-8H;(H,2,3,4,5) |
| InChIKey | AHILYVUFBGXJNT-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.65 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze perchloric acid;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perchloric acid;2-pyridin-2-ylpyridine?
The IUPAC name of perchloric acid;2-pyridin-2-ylpyridine (CID 71352928) is perchloric acid;2-pyridin-2-ylpyridine.
What is the SMILES notation for perchloric acid;2-pyridin-2-ylpyridine?
The canonical SMILES for perchloric acid;2-pyridin-2-ylpyridine is [O-][Cl+3]([O-])([O-])O.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of perchloric acid;2-pyridin-2-ylpyridine?
The InChIKey is AHILYVUFBGXJNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.ClHO4/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2-1(3,4)5/h1-8H;(H,2,3,4,5).
What are the key properties of perchloric acid;2-pyridin-2-ylpyridine?
perchloric acid;2-pyridin-2-ylpyridine has a molecular weight of 256.65 g/mol, XLogP of -1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for perchloric acid;2-pyridin-2-ylpyridine is sourced from PubChem (CID 71352928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).