C78H108BClFN5O6+ — CID 171788635
CID 171788635 (PubChem CID 171788635) has the molecular formula C78H108BClFN5O6+ and a molecular weight of 1277.01 g/mol.
| Compound Name | CID 171788635 |
|---|---|
| PubChem CID | 171788635 |
| Molecular Formula | C78H108BClFN5O6+ |
| Molecular Weight | 1277.01 g/mol |
| Exact Mass | 1275.81 |
| IUPAC Name | — |
| SMILES | CC/C(C(=O)OC(C)(C)C)=C(/CCCOc1cccc2cc(F)ccc12)c1ccc(Cl)c(C2=C(C)CC[N+](C)(C)C2C)c1C.CCCC(C)CC.[B]=CCCC(C(=O)NC)N1Cc2c(OCC(=O)N(CCC)CCC)cc(NCc3ccccc3)cc2C1=C1CCC1 |
| InChI | InChI=1S/C38H48ClFNO3.C33H44BN4O3.C7H16/c1-10-29(37(42)44-38(5,6)7)32(14-12-22-43-34-15-11-13-27-23-28(40)16-17-31(27)34)30-18-19-33(39)36(25(30)3)35-24(2)20-21-41(8,9)26(35)4;1-4-17-37(18-5-2)31(39)23-41-30-20-26(36-21-24-11-7-6-8-12-24)19-27-28(30)22-38(32(27)25-13-9-14-25)29(15-10-16-34)33(40)35-3;1-4-6-7(3)5-2/h11,13,15-19,23,26H,10,12,14,20-22H2,1-9H3;6-8,11-12,16,19-20,29,36H,4-5,9-10,13-15,17-18,21-23H2,1-3H3,(H,35,40);7H,4-6H2,1-3H3/q+1;;/b32-29+;; |
| InChIKey | BXDGFSJTOJVEHC-STHVEDFNSA-N |
| XLogP | 17.68 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1277.01 |
| LogP ≤ 5 | 17.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|