C38H46ClFO3 — CID 171789114
(E)-4-[4-chloro-3-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]-2-methylphenyl]-3-ethyl-7-(6-fluoronaphthalen-1-yl)oxy-1-[(2-methylpropan-2-yl)oxy]hept-3-en-2-one (PubChem CID 171789114) has the molecular formula C38H46ClFO3 and a molecular weight of 605.23 g/mol. Its IUPAC name is (E)-4-[4-chloro-3-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]-2-methylphenyl]-3-ethyl-7-(6-fluoronaphthalen-1-yl)oxy-1-[(2-methylpropan-2-yl)oxy]hept-3-en-2-one.
| Compound Name | (E)-4-[4-chloro-3-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]-2-methylphenyl]-3-ethyl-7-(6-fluoronaphthalen-1-yl)oxy-1-[(2-methylpropan-2-yl)oxy]hept-3-en-2-one |
|---|---|
| PubChem CID | 171789114 |
| Molecular Formula | C38H46ClFO3 |
| Molecular Weight | 605.23 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | (E)-4-[4-chloro-3-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]-2-methylphenyl]-3-ethyl-7-(6-fluoronaphthalen-1-yl)oxy-1-[(2-methylpropan-2-yl)oxy]hept-3-en-2-one |
| SMILES | C/C=C(/C)C(=C(C)C)c1c(Cl)ccc(/C(CCCOc2cccc3cc(F)ccc23)=C(\CC)C(=O)COC(C)(C)C)c1C |
| InChI | InChI=1S/C38H46ClFO3/c1-10-25(5)36(24(3)4)37-26(6)30(19-20-33(37)39)32(29(11-2)34(41)23-43-38(7,8)9)15-13-21-42-35-16-12-14-27-22-28(40)17-18-31(27)35/h10,12,14,16-20,22H,11,13,15,21,23H2,1-9H3/b25-10-,32-29+ |
| InChIKey | WBGPVMJPJRRHDN-ALSSATDWSA-N |
| XLogP | 11.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.23 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|