C37H43ClFNO3 — CID 171789026
6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-(3-methylbutyl)-7-[(2Z,4E)-3,5,6-trimethylhepta-2,4-dien-4-yl]indole-2-carboxylic acid (PubChem CID 171789026) has the molecular formula C37H43ClFNO3 and a molecular weight of 604.21 g/mol. Its IUPAC name is 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-(3-methylbutyl)-7-[(2Z,4E)-3,5,6-trimethylhepta-2,4-dien-4-yl]indole-2-carboxylic acid.
| Compound Name | 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-(3-methylbutyl)-7-[(2Z,4E)-3,5,6-trimethylhepta-2,4-dien-4-yl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 171789026 |
| Molecular Formula | C37H43ClFNO3 |
| Molecular Weight | 604.21 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-(3-methylbutyl)-7-[(2Z,4E)-3,5,6-trimethylhepta-2,4-dien-4-yl]indole-2-carboxylic acid |
| SMILES | C/C=C(C)\C(=C(\C)C(C)C)c1c(Cl)ccc2c(CCCOc3cccc4cc(F)ccc34)c(C(=O)O)n(CCC(C)C)c12 |
| InChI | InChI=1S/C37H43ClFNO3/c1-8-24(6)33(25(7)23(4)5)34-31(38)17-16-30-29(36(37(41)42)40(35(30)34)19-18-22(2)3)12-10-20-43-32-13-9-11-26-21-27(39)14-15-28(26)32/h8-9,11,13-17,21-23H,10,12,18-20H2,1-7H3,(H,41,42)/b24-8-,33-25+ |
| InChIKey | ZQTQCQGOSVIFRB-QKWHSMFOSA-N |
| XLogP | 10.74 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.21 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|