C30H31ClFNO3 — CID 171788604
6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-methyl-7-[(E)-4-methylhex-3-en-3-yl]indole-2-carboxylic acid (PubChem CID 171788604) has the molecular formula C30H31ClFNO3 and a molecular weight of 508.03 g/mol. Its IUPAC name is 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-methyl-7-[(E)-4-methylhex-3-en-3-yl]indole-2-carboxylic acid.
| Compound Name | 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-methyl-7-[(E)-4-methylhex-3-en-3-yl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 171788604 |
| Molecular Formula | C30H31ClFNO3 |
| Molecular Weight | 508.03 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-methyl-7-[(E)-4-methylhex-3-en-3-yl]indole-2-carboxylic acid |
| SMILES | CC/C(C)=C(\CC)c1c(Cl)ccc2c(CCCOc3cccc4cc(F)ccc34)c(C(=O)O)n(C)c12 |
| InChI | InChI=1S/C30H31ClFNO3/c1-5-18(3)21(6-2)27-25(31)15-14-24-23(29(30(34)35)33(4)28(24)27)10-8-16-36-26-11-7-9-19-17-20(32)12-13-22(19)26/h7,9,11-15,17H,5-6,8,10,16H2,1-4H3,(H,34,35)/b21-18+ |
| InChIKey | LQUACJCDGCYEIW-DYTRJAOYSA-N |
| XLogP | 8.43 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.03 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|