C36H41ClFNO3 — CID 174289789
butyl (E)-3-[4-chloro-2-methyl-3-(1,4,6-trimethyl-2H-pyridin-5-yl)phenyl]-6-(6-fluoronaphthalen-1-yl)oxy-2-methylhex-2-enoate (PubChem CID 174289789) has the molecular formula C36H41ClFNO3 and a molecular weight of 590.18 g/mol. Its IUPAC name is butyl (E)-3-[4-chloro-2-methyl-3-(1,4,6-trimethyl-2H-pyridin-5-yl)phenyl]-6-(6-fluoronaphthalen-1-yl)oxy-2-methylhex-2-enoate.
| Compound Name | butyl (E)-3-[4-chloro-2-methyl-3-(1,4,6-trimethyl-2H-pyridin-5-yl)phenyl]-6-(6-fluoronaphthalen-1-yl)oxy-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 174289789 |
| Molecular Formula | C36H41ClFNO3 |
| Molecular Weight | 590.18 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | butyl (E)-3-[4-chloro-2-methyl-3-(1,4,6-trimethyl-2H-pyridin-5-yl)phenyl]-6-(6-fluoronaphthalen-1-yl)oxy-2-methylhex-2-enoate |
| SMILES | CCCCOC(=O)/C(C)=C(\CCCOc1cccc2cc(F)ccc12)c1ccc(Cl)c(C2=C(C)N(C)CC=C2C)c1C |
| InChI | InChI=1S/C36H41ClFNO3/c1-7-8-20-42-36(40)25(4)29(12-10-21-41-33-13-9-11-27-22-28(38)14-15-31(27)33)30-16-17-32(37)35(24(30)3)34-23(2)18-19-39(6)26(34)5/h9,11,13-18,22H,7-8,10,12,19-21H2,1-6H3/b29-25+ |
| InChIKey | OZIFGMQJGMBQTN-XLVZBRSZSA-N |
| XLogP | 9.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.18 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|