C37H44ClFNO3+ — CID 171788576
tert-butyl (E)-3-[4-chloro-2-methyl-3-(1,4,6-trimethyl-2,3-dihydropyridin-1-ium-5-yl)phenyl]-2-ethyl-6-(6-fluoronaphthalen-1-yl)oxyhex-2-enoate (PubChem CID 171788576) has the molecular formula C37H44ClFNO3+ and a molecular weight of 605.21 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-chloro-2-methyl-3-(1,4,6-trimethyl-2,3-dihydropyridin-1-ium-5-yl)phenyl]-2-ethyl-6-(6-fluoronaphthalen-1-yl)oxyhex-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-chloro-2-methyl-3-(1,4,6-trimethyl-2,3-dihydropyridin-1-ium-5-yl)phenyl]-2-ethyl-6-(6-fluoronaphthalen-1-yl)oxyhex-2-enoate |
|---|---|
| PubChem CID | 171788576 |
| Molecular Formula | C37H44ClFNO3+ |
| Molecular Weight | 605.21 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | tert-butyl (E)-3-[4-chloro-2-methyl-3-(1,4,6-trimethyl-2,3-dihydropyridin-1-ium-5-yl)phenyl]-2-ethyl-6-(6-fluoronaphthalen-1-yl)oxyhex-2-enoate |
| SMILES | CC/C(C(=O)OC(C)(C)C)=C(/CCCOc1cccc2cc(F)ccc12)c1ccc(Cl)c(C2=C(C)CC[N+](C)=C2C)c1C |
| InChI | InChI=1S/C37H44ClFNO3/c1-9-28(36(41)43-37(5,6)7)31(13-11-21-42-33-14-10-12-26-22-27(39)15-16-30(26)33)29-17-18-32(38)35(24(29)3)34-23(2)19-20-40(8)25(34)4/h10,12,14-18,22H,9,11,13,19-21H2,1-8H3/q+1/b31-28+ |
| InChIKey | OVMFLOVURRAVFB-CCFHIKDMSA-N |
| XLogP | 9.59 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.21 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|