C18H19F3N2O5S — CID 171792185
[5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]quinolin-7-yl] trifluoromethanesulfonate (PubChem CID 171792185) has the molecular formula C18H19F3N2O5S and a molecular weight of 432.42 g/mol. Its IUPAC name is [5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]quinolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]quinolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171792185 |
| Molecular Formula | C18H19F3N2O5S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | [5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]quinolin-7-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC1(c2cc(OS(=O)(=O)C(F)(F)F)cc3ncccc23)CC1 |
| InChI | InChI=1S/C18H19F3N2O5S/c1-16(2,3)27-15(24)23-17(6-7-17)13-9-11(28-29(25,26)18(19,20)21)10-14-12(13)5-4-8-22-14/h4-5,8-10H,6-7H2,1-3H3,(H,23,24) |
| InChIKey | LVRNLYDRPRFIGV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|