C23H26ClN5O — CID 171793415
N'-[3-[(3-anilino-6-chloro-9H-carbazol-1-yl)oxy]propyl]methanimidamide;methanamine (PubChem CID 171793415) has the molecular formula C23H26ClN5O and a molecular weight of 423.95 g/mol. Its IUPAC name is N'-[3-[(3-anilino-6-chloro-9H-carbazol-1-yl)oxy]propyl]methanimidamide;methanamine.
| Compound Name | N'-[3-[(3-anilino-6-chloro-9H-carbazol-1-yl)oxy]propyl]methanimidamide;methanamine |
|---|---|
| PubChem CID | 171793415 |
| Molecular Formula | C23H26ClN5O |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N'-[3-[(3-anilino-6-chloro-9H-carbazol-1-yl)oxy]propyl]methanimidamide;methanamine |
| SMILES | CN.N/C=N/CCCOc1cc(Nc2ccccc2)cc2c1[nH]c1ccc(Cl)cc12 |
| InChI | InChI=1S/C22H21ClN4O.CH5N/c23-15-7-8-20-18(11-15)19-12-17(26-16-5-2-1-3-6-16)13-21(22(19)27-20)28-10-4-9-25-14-24;1-2/h1-3,5-8,11-14,26-27H,4,9-10H2,(H2,24,25);2H2,1H3 |
| InChIKey | GRIFRKDNNLDDLJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|