C20H16Cl3N5 — CID 171794080
N'-[2-[6-chloro-3-[(4,5-dichloro-2-pyridinyl)amino]-9H-carbazol-1-yl]ethyl]methanimidamide (PubChem CID 171794080) has the molecular formula C20H16Cl3N5 and a molecular weight of 432.74 g/mol. Its IUPAC name is N'-[2-[6-chloro-3-[(4,5-dichloro-2-pyridinyl)amino]-9H-carbazol-1-yl]ethyl]methanimidamide.
| Compound Name | N'-[2-[6-chloro-3-[(4,5-dichloro-2-pyridinyl)amino]-9H-carbazol-1-yl]ethyl]methanimidamide |
|---|---|
| PubChem CID | 171794080 |
| Molecular Formula | C20H16Cl3N5 |
| Molecular Weight | 432.74 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | N'-[2-[6-chloro-3-[(4,5-dichloro-2-pyridinyl)amino]-9H-carbazol-1-yl]ethyl]methanimidamide |
| SMILES | N/C=N/CCc1cc(Nc2cc(Cl)c(Cl)cn2)cc2c1[nH]c1ccc(Cl)cc12 |
| InChI | InChI=1S/C20H16Cl3N5/c21-12-1-2-18-14(6-12)15-7-13(27-19-8-16(22)17(23)9-26-19)5-11(20(15)28-18)3-4-25-10-24/h1-2,5-10,28H,3-4H2,(H2,24,25)(H,26,27) |
| InChIKey | CRWSKERJQLRUHG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.74 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|