C22H16Cl3N5 — CID 171793911
N'-[2-[6,7-dichloro-3-(4-chloro-3-cyanoanilino)-9H-carbazol-1-yl]ethyl]methanimidamide (PubChem CID 171793911) has the molecular formula C22H16Cl3N5 and a molecular weight of 456.76 g/mol. Its IUPAC name is N'-[2-[6,7-dichloro-3-(4-chloro-3-cyanoanilino)-9H-carbazol-1-yl]ethyl]methanimidamide.
| Compound Name | N'-[2-[6,7-dichloro-3-(4-chloro-3-cyanoanilino)-9H-carbazol-1-yl]ethyl]methanimidamide |
|---|---|
| PubChem CID | 171793911 |
| Molecular Formula | C22H16Cl3N5 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | N'-[2-[6,7-dichloro-3-(4-chloro-3-cyanoanilino)-9H-carbazol-1-yl]ethyl]methanimidamide |
| SMILES | N#Cc1cc(Nc2cc(CC/N=C/N)c3[nH]c4cc(Cl)c(Cl)cc4c3c2)ccc1Cl |
| InChI | InChI=1S/C22H16Cl3N5/c23-18-2-1-14(6-13(18)10-26)29-15-5-12(3-4-28-11-27)22-17(7-15)16-8-19(24)20(25)9-21(16)30-22/h1-2,5-9,11,29-30H,3-4H2,(H2,27,28) |
| InChIKey | NIVGPORRRDQNNZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|