C17H21Cl2N5 — CID 171793330
2-[2-[(6,7-dichloro-9H-carbazol-3-yl)amino]ethyl]guanidine;ethane (PubChem CID 171793330) has the molecular formula C17H21Cl2N5 and a molecular weight of 366.30 g/mol. Its IUPAC name is 2-[2-[(6,7-dichloro-9H-carbazol-3-yl)amino]ethyl]guanidine;ethane.
| Compound Name | 2-[2-[(6,7-dichloro-9H-carbazol-3-yl)amino]ethyl]guanidine;ethane |
|---|---|
| PubChem CID | 171793330 |
| Molecular Formula | C17H21Cl2N5 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-[2-[(6,7-dichloro-9H-carbazol-3-yl)amino]ethyl]guanidine;ethane |
| SMILES | CC.NC(N)=NCCNc1ccc2[nH]c3cc(Cl)c(Cl)cc3c2c1 |
| InChI | InChI=1S/C15H15Cl2N5.C2H6/c16-11-6-10-9-5-8(20-3-4-21-15(18)19)1-2-13(9)22-14(10)7-12(11)17;1-2/h1-2,5-7,20,22H,3-4H2,(H4,18,19,21);1-2H3 |
| InChIKey | XGJWTUGQQWUHDY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|