C23H23Cl3FN5 — CID 171793421
2-[2-[6-chloro-3-(2,4-dichloro-5-fluoroanilino)-9H-carbazol-1-yl]ethyl]guanidine;ethane (PubChem CID 171793421) has the molecular formula C23H23Cl3FN5 and a molecular weight of 494.83 g/mol. Its IUPAC name is 2-[2-[6-chloro-3-(2,4-dichloro-5-fluoroanilino)-9H-carbazol-1-yl]ethyl]guanidine;ethane.
| Compound Name | 2-[2-[6-chloro-3-(2,4-dichloro-5-fluoroanilino)-9H-carbazol-1-yl]ethyl]guanidine;ethane |
|---|---|
| PubChem CID | 171793421 |
| Molecular Formula | C23H23Cl3FN5 |
| Molecular Weight | 494.83 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-[2-[6-chloro-3-(2,4-dichloro-5-fluoroanilino)-9H-carbazol-1-yl]ethyl]guanidine;ethane |
| SMILES | CC.NC(N)=NCCc1cc(Nc2cc(F)c(Cl)cc2Cl)cc2c1[nH]c1ccc(Cl)cc12 |
| InChI | InChI=1S/C21H17Cl3FN5.C2H6/c22-11-1-2-18-13(6-11)14-7-12(29-19-9-17(25)15(23)8-16(19)24)5-10(20(14)30-18)3-4-28-21(26)27;1-2/h1-2,5-9,29-30H,3-4H2,(H4,26,27,28);1-2H3 |
| InChIKey | WUMABKAAHMEOPF-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 92.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.83 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|