C19H20ClN7 — CID 171793896
1-[2-[6-chloro-3-(1H-pyrazol-5-ylamino)-9H-carbazol-1-yl]ethyl]-2-methylguanidine (PubChem CID 171793896) has the molecular formula C19H20ClN7 and a molecular weight of 381.87 g/mol. Its IUPAC name is 1-[2-[6-chloro-3-(1H-pyrazol-5-ylamino)-9H-carbazol-1-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[6-chloro-3-(1H-pyrazol-5-ylamino)-9H-carbazol-1-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 171793896 |
| Molecular Formula | C19H20ClN7 |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-[2-[6-chloro-3-(1H-pyrazol-5-ylamino)-9H-carbazol-1-yl]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCCc1cc(Nc2ccn[nH]2)cc2c1[nH]c1ccc(Cl)cc12 |
| InChI | InChI=1S/C19H20ClN7/c1-22-19(21)23-6-4-11-8-13(25-17-5-7-24-27-17)10-15-14-9-12(20)2-3-16(14)26-18(11)15/h2-3,5,7-10,26H,4,6H2,1H3,(H3,21,22,23)(H2,24,25,27) |
| InChIKey | XBMULZRRJGZXID-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|