C18H18ClN7 — CID 171793695
2-[2-[6-chloro-3-(1H-pyrazol-4-ylamino)-9H-carbazol-1-yl]ethyl]guanidine (PubChem CID 171793695) has the molecular formula C18H18ClN7 and a molecular weight of 367.84 g/mol. Its IUPAC name is 2-[2-[6-chloro-3-(1H-pyrazol-4-ylamino)-9H-carbazol-1-yl]ethyl]guanidine.
| Compound Name | 2-[2-[6-chloro-3-(1H-pyrazol-4-ylamino)-9H-carbazol-1-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 171793695 |
| Molecular Formula | C18H18ClN7 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[2-[6-chloro-3-(1H-pyrazol-4-ylamino)-9H-carbazol-1-yl]ethyl]guanidine |
| SMILES | NC(N)=NCCc1cc(Nc2cn[nH]c2)cc2c1[nH]c1ccc(Cl)cc12 |
| InChI | InChI=1S/C18H18ClN7/c19-11-1-2-16-14(6-11)15-7-12(25-13-8-23-24-9-13)5-10(17(15)26-16)3-4-22-18(20)21/h1-2,5-9,25-26H,3-4H2,(H,23,24)(H4,20,21,22) |
| InChIKey | LTSJKZGDWVDLTH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|