About 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine
1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine (PubChem CID 174337362) has the molecular formula C21H19Cl2N3
and a molecular weight of 384.31 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine.
Molecular Properties
| Compound Name | 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine |
| PubChem CID | 174337362 |
| Molecular Formula | C21H19Cl2N3 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine |
| SMILES | Cc1ccc2[nH]c3c(CCN)cc(Nc4ccc(Cl)c(Cl)c4)cc3c2c1 |
| InChI | InChI=1S/C21H19Cl2N3/c1-12-2-5-20-16(8-12)17-10-15(9-13(6-7-24)21(17)26-20)25-14-3-4-18(22)19(23)11-14/h2-5,8-11,25-26H,6-7,24H2,1H3 |
| InChIKey | HAWSFILCQQSQLL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine?
The IUPAC name of 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine (CID 174337362) is 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine.
What is the SMILES notation for 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine?
The canonical SMILES for 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine is Cc1ccc2[nH]c3c(CCN)cc(Nc4ccc(Cl)c(Cl)c4)cc3c2c1.
What is the InChIKey of 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine?
The InChIKey is HAWSFILCQQSQLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19Cl2N3/c1-12-2-5-20-16(8-12)17-10-15(9-13(6-7-24)21(17)26-20)25-14-3-4-18(22)19(23)11-14/h2-5,8-11,25-26H,6-7,24H2,1H3.
What are the key properties of 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine?
1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine has a molecular weight of 384.31 g/mol, XLogP of 6.18, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethyl)-N-(3,4-dichlorophenyl)-6-methyl-9H-carbazol-3-amine is sourced from PubChem (CID 174337362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).