C21H20ClN3 — CID 171793556
1-(2-aminoethyl)-N-(2-chloro-4-methylphenyl)-9H-carbazol-3-amine (PubChem CID 171793556) has the molecular formula C21H20ClN3 and a molecular weight of 349.87 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(2-chloro-4-methylphenyl)-9H-carbazol-3-amine.
| Compound Name | 1-(2-aminoethyl)-N-(2-chloro-4-methylphenyl)-9H-carbazol-3-amine |
|---|---|
| PubChem CID | 171793556 |
| Molecular Formula | C21H20ClN3 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-(2-aminoethyl)-N-(2-chloro-4-methylphenyl)-9H-carbazol-3-amine |
| SMILES | Cc1ccc(Nc2cc(CCN)c3[nH]c4ccccc4c3c2)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClN3/c1-13-6-7-20(18(22)10-13)24-15-11-14(8-9-23)21-17(12-15)16-4-2-3-5-19(16)25-21/h2-7,10-12,24-25H,8-9,23H2,1H3 |
| InChIKey | RWGOOTLFKPKQJZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |