C22H22ClN3 — CID 156868408
N-(4-chlorophenyl)-1-[2-(dimethylamino)ethyl]-9H-carbazol-3-amine (PubChem CID 156868408) has the molecular formula C22H22ClN3 and a molecular weight of 363.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-[2-(dimethylamino)ethyl]-9H-carbazol-3-amine.
| Compound Name | N-(4-chlorophenyl)-1-[2-(dimethylamino)ethyl]-9H-carbazol-3-amine |
|---|---|
| PubChem CID | 156868408 |
| Molecular Formula | C22H22ClN3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-(4-chlorophenyl)-1-[2-(dimethylamino)ethyl]-9H-carbazol-3-amine |
| SMILES | CN(C)CCc1cc(Nc2ccc(Cl)cc2)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C22H22ClN3/c1-26(2)12-11-15-13-18(24-17-9-7-16(23)8-10-17)14-20-19-5-3-4-6-21(19)25-22(15)20/h3-10,13-14,24-25H,11-12H2,1-2H3 |
| InChIKey | PNQMWIHCJOCDQM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |