C21H19Cl2N5 — CID 171793368
2-[[6-chloro-3-(3-chloro-4-methylanilino)-9H-carbazol-1-yl]methyl]guanidine (PubChem CID 171793368) has the molecular formula C21H19Cl2N5 and a molecular weight of 412.32 g/mol. Its IUPAC name is 2-[[6-chloro-3-(3-chloro-4-methylanilino)-9H-carbazol-1-yl]methyl]guanidine.
| Compound Name | 2-[[6-chloro-3-(3-chloro-4-methylanilino)-9H-carbazol-1-yl]methyl]guanidine |
|---|---|
| PubChem CID | 171793368 |
| Molecular Formula | C21H19Cl2N5 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-[[6-chloro-3-(3-chloro-4-methylanilino)-9H-carbazol-1-yl]methyl]guanidine |
| SMILES | Cc1ccc(Nc2cc(CN=C(N)N)c3[nH]c4ccc(Cl)cc4c3c2)cc1Cl |
| InChI | InChI=1S/C21H19Cl2N5/c1-11-2-4-14(9-18(11)23)27-15-6-12(10-26-21(24)25)20-17(8-15)16-7-13(22)3-5-19(16)28-20/h2-9,27-28H,10H2,1H3,(H4,24,25,26) |
| InChIKey | UFPKHRKPXDXGIR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 92.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|