C29H30Cl3N5 — CID 171793962
6,7-dichloro-N-(4-chlorophenyl)-1-[2-(4-methylanilino)ethyl]-9H-carbazol-3-amine;methanamine;methanimine (PubChem CID 171793962) has the molecular formula C29H30Cl3N5 and a molecular weight of 554.95 g/mol. Its IUPAC name is 6,7-dichloro-N-(4-chlorophenyl)-1-[2-(4-methylanilino)ethyl]-9H-carbazol-3-amine;methanamine;methanimine.
| Compound Name | 6,7-dichloro-N-(4-chlorophenyl)-1-[2-(4-methylanilino)ethyl]-9H-carbazol-3-amine;methanamine;methanimine |
|---|---|
| PubChem CID | 171793962 |
| Molecular Formula | C29H30Cl3N5 |
| Molecular Weight | 554.95 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 6,7-dichloro-N-(4-chlorophenyl)-1-[2-(4-methylanilino)ethyl]-9H-carbazol-3-amine;methanamine;methanimine |
| SMILES | CN.Cc1ccc(NCCc2cc(Nc3ccc(Cl)cc3)cc3c2[nH]c2cc(Cl)c(Cl)cc23)cc1.[H]N=C |
| InChI | InChI=1S/C27H22Cl3N3.CH5N.CH3N/c1-16-2-6-19(7-3-16)31-11-10-17-12-21(32-20-8-4-18(28)5-9-20)13-23-22-14-24(29)25(30)15-26(22)33-27(17)23;2*1-2/h2-9,12-15,31-33H,10-11H2,1H3;2H2,1H3;2H,1H2 |
| InChIKey | XYEITCYIQJDZIF-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.95 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|