C27H30ClN3O2 — CID 171793465
tert-butyl N-[2-[6-chloro-7-methyl-3-(4-methylanilino)-9H-carbazol-1-yl]ethyl]carbamate (PubChem CID 171793465) has the molecular formula C27H30ClN3O2 and a molecular weight of 464.01 g/mol. Its IUPAC name is tert-butyl N-[2-[6-chloro-7-methyl-3-(4-methylanilino)-9H-carbazol-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-chloro-7-methyl-3-(4-methylanilino)-9H-carbazol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 171793465 |
| Molecular Formula | C27H30ClN3O2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | tert-butyl N-[2-[6-chloro-7-methyl-3-(4-methylanilino)-9H-carbazol-1-yl]ethyl]carbamate |
| SMILES | Cc1ccc(Nc2cc(CCNC(=O)OC(C)(C)C)c3[nH]c4cc(C)c(Cl)cc4c3c2)cc1 |
| InChI | InChI=1S/C27H30ClN3O2/c1-16-6-8-19(9-7-16)30-20-13-18(10-11-29-26(32)33-27(3,4)5)25-22(14-20)21-15-23(28)17(2)12-24(21)31-25/h6-9,12-15,30-31H,10-11H2,1-5H3,(H,29,32) |
| InChIKey | XPHYFZAQIPOBHB-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |