C28H32BCl3N5O2 — CID 171793503
CID 171793503 (PubChem CID 171793503) has the molecular formula C28H32BCl3N5O2 and a molecular weight of 587.77 g/mol.
| Compound Name | CID 171793503 |
|---|---|
| PubChem CID | 171793503 |
| Molecular Formula | C28H32BCl3N5O2 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | — |
| SMILES | C=C(NCCc1cc(Nc2cnc(Cl)c(Cl)c2)cc2c1[nH]c1ccc(Cl)cc12)NC(=O)OC(C)(C)C.C[B]C |
| InChI | InChI=1S/C26H26Cl3N5O2.C2H6B/c1-14(32-25(35)36-26(2,3)4)30-8-7-15-9-17(33-18-12-21(28)24(29)31-13-18)11-20-19-10-16(27)5-6-22(19)34-23(15)20;1-3-2/h5-6,9-13,30,33-34H,1,7-8H2,2-4H3,(H,32,35);1-2H3 |
| InChIKey | NKEAILDYHRNZTD-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|