About CID 171793503
CID 171793503 (PubChem CID 171793503) has the molecular formula C28H32BCl3N5O2
and a molecular weight of 587.77 g/mol.
Molecular Properties
| Compound Name | CID 171793503 |
| PubChem CID | 171793503 |
| Molecular Formula | C28H32BCl3N5O2 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | — |
| SMILES | C=C(NCCc1cc(Nc2cnc(Cl)c(Cl)c2)cc2c1[nH]c1ccc(Cl)cc12)NC(=O)OC(C)(C)C.C[B]C |
| InChI | InChI=1S/C26H26Cl3N5O2.C2H6B/c1-14(32-25(35)36-26(2,3)4)30-8-7-15-9-17(33-18-12-21(28)24(29)31-13-18)11-20-19-10-16(27)5-6-22(19)34-23(15)20;1-3-2/h5-6,9-13,30,33-34H,1,7-8H2,2-4H3,(H,32,35);1-2H3 |
| InChIKey | NKEAILDYHRNZTD-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 171793503 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171793503?
The IUPAC name of CID 171793503 (CID 171793503) is not available.
What is the SMILES notation for CID 171793503?
The canonical SMILES for CID 171793503 is C=C(NCCc1cc(Nc2cnc(Cl)c(Cl)c2)cc2c1[nH]c1ccc(Cl)cc12)NC(=O)OC(C)(C)C.C[B]C.
What is the InChIKey of CID 171793503?
The InChIKey is NKEAILDYHRNZTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26Cl3N5O2.C2H6B/c1-14(32-25(35)36-26(2,3)4)30-8-7-15-9-17(33-18-12-21(28)24(29)31-13-18)11-20-19-10-16(27)5-6-22(19)34-23(15)20;1-3-2/h5-6,9-13,30,33-34H,1,7-8H2,2-4H3,(H,32,35);1-2H3.
What are the key properties of CID 171793503?
CID 171793503 has a molecular weight of 587.77 g/mol, XLogP of 8.33, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171793503 is sourced from PubChem (CID 171793503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).