C22H31FNY- — CID 171799778
2-fluoro-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethynyl]cyclohexane-1-carbonitrile;yttrium (PubChem CID 171799778) has the molecular formula C22H31FNY- and a molecular weight of 417.40 g/mol. Its IUPAC name is 2-fluoro-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethynyl]cyclohexane-1-carbonitrile;yttrium.
| Compound Name | 2-fluoro-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethynyl]cyclohexane-1-carbonitrile;yttrium |
|---|---|
| PubChem CID | 171799778 |
| Molecular Formula | C22H31FNY- |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-fluoro-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethynyl]cyclohexane-1-carbonitrile;yttrium |
| SMILES | CC1CCC(C2CCC(C#CC3[CH-]CC(C#N)C(F)C3)CC2)CC1.[Y] |
| InChI | InChI=1S/C22H31FN.Y/c1-16-2-9-19(10-3-16)20-11-6-17(7-12-20)4-5-18-8-13-21(15-24)22(23)14-18;/h8,16-22H,2-3,6-7,9-14H2,1H3;/q-1; |
| InChIKey | NIIDVLWYBVZICW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|