C22H33F2Y- — CID 171799782
1,3-difluoro-5-methyl-2-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethynyl]cyclohexane;yttrium (PubChem CID 171799782) has the molecular formula C22H33F2Y- and a molecular weight of 424.41 g/mol. Its IUPAC name is 1,3-difluoro-5-methyl-2-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethynyl]cyclohexane;yttrium.
| Compound Name | 1,3-difluoro-5-methyl-2-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethynyl]cyclohexane;yttrium |
|---|---|
| PubChem CID | 171799782 |
| Molecular Formula | C22H33F2Y- |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 1,3-difluoro-5-methyl-2-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethynyl]cyclohexane;yttrium |
| SMILES | CC1[CH-]C(F)C(C#CC2CCC(C3CCC(C)CC3)CC2)C(F)C1.[Y] |
| InChI | InChI=1S/C22H33F2.Y/c1-15-3-8-18(9-4-15)19-10-5-17(6-11-19)7-12-20-21(23)13-16(2)14-22(20)24;/h13,15-22H,3-6,8-11,14H2,1-2H3;/q-1; |
| InChIKey | AZXPECDQNSTNAE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|