C26H42N4O9 — CID 171804525
[2-[2-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]ethylcarbamoyl]-4-formamidophenyl]methyl 2-methylpropanoate (PubChem CID 171804525) has the molecular formula C26H42N4O9 and a molecular weight of 554.64 g/mol. Its IUPAC name is [2-[2-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]ethylcarbamoyl]-4-formamidophenyl]methyl 2-methylpropanoate.
| Compound Name | [2-[2-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]ethylcarbamoyl]-4-formamidophenyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 171804525 |
| Molecular Formula | C26H42N4O9 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | [2-[2-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]ethylcarbamoyl]-4-formamidophenyl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCc1ccc(NC=O)cc1C(=O)NCCNC(=O)CCOCCOCCOCCOCCN |
| InChI | InChI=1S/C26H42N4O9/c1-20(2)26(34)39-18-21-3-4-22(30-19-31)17-23(21)25(33)29-8-7-28-24(32)5-9-35-11-13-37-15-16-38-14-12-36-10-6-27/h3-4,17,19-20H,5-16,18,27H2,1-2H3,(H,28,32)(H,29,33)(H,30,31) |
| InChIKey | FANPLQHGQOKLLR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 176.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|