C19H13ClFN5O4S — CID 171812941
N-[5-chloro-6-(4-fluorophenyl)-3-pyridinyl]-7-methyl-2,3-dioxo-1,4-dihydropyrido[2,3-b]pyrazine-6-sulfonamide (PubChem CID 171812941) has the molecular formula C19H13ClFN5O4S and a molecular weight of 461.86 g/mol. Its IUPAC name is N-[5-chloro-6-(4-fluorophenyl)-3-pyridinyl]-7-methyl-2,3-dioxo-1,4-dihydropyrido[2,3-b]pyrazine-6-sulfonamide.
| Compound Name | N-[5-chloro-6-(4-fluorophenyl)-3-pyridinyl]-7-methyl-2,3-dioxo-1,4-dihydropyrido[2,3-b]pyrazine-6-sulfonamide |
|---|---|
| PubChem CID | 171812941 |
| Molecular Formula | C19H13ClFN5O4S |
| Molecular Weight | 461.86 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | N-[5-chloro-6-(4-fluorophenyl)-3-pyridinyl]-7-methyl-2,3-dioxo-1,4-dihydropyrido[2,3-b]pyrazine-6-sulfonamide |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2nc1S(=O)(=O)Nc1cnc(-c2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H13ClFN5O4S/c1-9-6-14-16(24-18(28)17(27)23-14)25-19(9)31(29,30)26-12-7-13(20)15(22-8-12)10-2-4-11(21)5-3-10/h2-8,26H,1H3,(H,23,27)(H,24,25,28) |
| InChIKey | HEZGBQUKNMCSPH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.86 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|