C50H99NO7Si2 — CID 171814618
[(Z)-non-2-enyl] 7-[tert-butyl(dimethyl)silyl]oxy-8-[[2-[tert-butyl(dimethyl)silyl]oxy-8-[(Z)-non-2-enoxy]-8-oxooctyl]-(4-hydroxybutyl)amino]octanoate (PubChem CID 171814618) has the molecular formula C50H99NO7Si2 and a molecular weight of 882.51 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 7-[tert-butyl(dimethyl)silyl]oxy-8-[[2-[tert-butyl(dimethyl)silyl]oxy-8-[(Z)-non-2-enoxy]-8-oxooctyl]-(4-hydroxybutyl)amino]octanoate.
| Compound Name | [(Z)-non-2-enyl] 7-[tert-butyl(dimethyl)silyl]oxy-8-[[2-[tert-butyl(dimethyl)silyl]oxy-8-[(Z)-non-2-enoxy]-8-oxooctyl]-(4-hydroxybutyl)amino]octanoate |
|---|---|
| PubChem CID | 171814618 |
| Molecular Formula | C50H99NO7Si2 |
| Molecular Weight | 882.51 g/mol |
| Exact Mass | 881.70 |
| IUPAC Name | [(Z)-non-2-enyl] 7-[tert-butyl(dimethyl)silyl]oxy-8-[[2-[tert-butyl(dimethyl)silyl]oxy-8-[(Z)-non-2-enoxy]-8-oxooctyl]-(4-hydroxybutyl)amino]octanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCC(CN(CCCCO)CC(CCCCCC(=O)OC/C=C\CCCCCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C50H99NO7Si2/c1-13-15-17-19-21-23-33-41-55-47(53)37-29-25-27-35-45(57-59(9,10)49(3,4)5)43-51(39-31-32-40-52)44-46(58-60(11,12)50(6,7)8)36-28-26-30-38-48(54)56-42-34-24-22-20-18-16-14-2/h23-24,33-34,45-46,52H,13-22,25-32,35-44H2,1-12H3/b33-23-,34-24- |
| InChIKey | GXMWECPYZOZXMC-DQWRGTGXSA-N |
| XLogP | 13.88 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.51 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|