C58H116N2O9 — CID 171814650
bis[6-[bis(2-hydroxydecyl)amino]hexyl] 3-hydroxy-3-methylpentanedioate (PubChem CID 171814650) has the molecular formula C58H116N2O9 and a molecular weight of 985.57 g/mol. Its IUPAC name is bis[6-[bis(2-hydroxydecyl)amino]hexyl] 3-hydroxy-3-methylpentanedioate.
| Compound Name | bis[6-[bis(2-hydroxydecyl)amino]hexyl] 3-hydroxy-3-methylpentanedioate |
|---|---|
| PubChem CID | 171814650 |
| Molecular Formula | C58H116N2O9 |
| Molecular Weight | 985.57 g/mol |
| Exact Mass | 984.87 |
| IUPAC Name | bis[6-[bis(2-hydroxydecyl)amino]hexyl] 3-hydroxy-3-methylpentanedioate |
| SMILES | CCCCCCCCC(O)CN(CCCCCCOC(=O)CC(C)(O)CC(=O)OCCCCCCN(CC(O)CCCCCCCC)CC(O)CCCCCCCC)CC(O)CCCCCCCC |
| InChI | InChI=1S/C58H116N2O9/c1-6-10-14-18-22-30-38-52(61)48-59(49-53(62)39-31-23-19-15-11-7-2)42-34-26-28-36-44-68-56(65)46-58(5,67)47-57(66)69-45-37-29-27-35-43-60(50-54(63)40-32-24-20-16-12-8-3)51-55(64)41-33-25-21-17-13-9-4/h52-55,61-64,67H,6-51H2,1-5H3 |
| InChIKey | HNLVHKDICIHXIN-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 160.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.57 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|