C28H55N3O6 — CID 171814534
1-O-[5-[2-aminoheptyl(2-nitrosooctyl)amino]pentyl] 5-O-ethyl 3-hydroxy-3-methylpentanedioate (PubChem CID 171814534) has the molecular formula C28H55N3O6 and a molecular weight of 529.76 g/mol. Its IUPAC name is 1-O-[5-[2-aminoheptyl(2-nitrosooctyl)amino]pentyl] 5-O-ethyl 3-hydroxy-3-methylpentanedioate.
| Compound Name | 1-O-[5-[2-aminoheptyl(2-nitrosooctyl)amino]pentyl] 5-O-ethyl 3-hydroxy-3-methylpentanedioate |
|---|---|
| PubChem CID | 171814534 |
| Molecular Formula | C28H55N3O6 |
| Molecular Weight | 529.76 g/mol |
| Exact Mass | 529.41 |
| IUPAC Name | 1-O-[5-[2-aminoheptyl(2-nitrosooctyl)amino]pentyl] 5-O-ethyl 3-hydroxy-3-methylpentanedioate |
| SMILES | CCCCCCC(CN(CCCCCOC(=O)CC(C)(O)CC(=O)OCC)CC(N)CCCCC)N=O |
| InChI | InChI=1S/C28H55N3O6/c1-5-8-10-13-17-25(30-35)23-31(22-24(29)16-12-9-6-2)18-14-11-15-19-37-27(33)21-28(4,34)20-26(32)36-7-3/h24-25,34H,5-23,29H2,1-4H3 |
| InChIKey | CWJXKVZWKHTCCZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.76 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|