C29H36FN3O5S — CID 171828825
ethyl 7-[4-(6-aminohexylsulfamoyl)-3,5-dimethylphenyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 171828825) has the molecular formula C29H36FN3O5S and a molecular weight of 557.69 g/mol. Its IUPAC name is ethyl 7-[4-(6-aminohexylsulfamoyl)-3,5-dimethylphenyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-[4-(6-aminohexylsulfamoyl)-3,5-dimethylphenyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 171828825 |
| Molecular Formula | C29H36FN3O5S |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | ethyl 7-[4-(6-aminohexylsulfamoyl)-3,5-dimethylphenyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2cc(-c3cc(C)c(S(=O)(=O)NCCCCCCN)c(C)c3)c(F)cc2c1=O |
| InChI | InChI=1S/C29H36FN3O5S/c1-4-38-29(35)24-17-33(21-9-10-21)26-16-22(25(30)15-23(26)27(24)34)20-13-18(2)28(19(3)14-20)39(36,37)32-12-8-6-5-7-11-31/h13-17,21,32H,4-12,31H2,1-3H3 |
| InChIKey | NKICGDQMFYEKRX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|