C33H42F3N3O3 — CID 171833277
N-[2-cyclopropyl-5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pent-1-en-3-yl]-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide (PubChem CID 171833277) has the molecular formula C33H42F3N3O3 and a molecular weight of 585.71 g/mol. Its IUPAC name is N-[2-cyclopropyl-5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pent-1-en-3-yl]-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide.
| Compound Name | N-[2-cyclopropyl-5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pent-1-en-3-yl]-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 171833277 |
| Molecular Formula | C33H42F3N3O3 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | N-[2-cyclopropyl-5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pent-1-en-3-yl]-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide |
| SMILES | C=C(C1CC1)C(CCOCCCCc1ccc2c(n1)NCCC2)NC(=O)C1(c2cccc(C(F)(F)F)c2)CCOCC1 |
| InChI | InChI=1S/C33H42F3N3O3/c1-23(24-10-11-24)29(14-19-41-18-3-2-9-28-13-12-25-6-5-17-37-30(25)38-28)39-31(40)32(15-20-42-21-16-32)26-7-4-8-27(22-26)33(34,35)36/h4,7-8,12-13,22,24,29H,1-3,5-6,9-11,14-21H2,(H,37,38)(H,39,40) |
| InChIKey | ZJCIBJRYHKGHNL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|