C29H37BrN4O3 — CID 171832946
1-(2-bromo-6-oxo-1-pyridinyl)-N-[2-cyclopropyl-5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pent-1-en-3-yl]cyclopropane-1-carboxamide (PubChem CID 171832946) has the molecular formula C29H37BrN4O3 and a molecular weight of 569.54 g/mol. Its IUPAC name is 1-(2-bromo-6-oxo-1-pyridinyl)-N-[2-cyclopropyl-5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pent-1-en-3-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(2-bromo-6-oxo-1-pyridinyl)-N-[2-cyclopropyl-5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pent-1-en-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 171832946 |
| Molecular Formula | C29H37BrN4O3 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 1-(2-bromo-6-oxo-1-pyridinyl)-N-[2-cyclopropyl-5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pent-1-en-3-yl]cyclopropane-1-carboxamide |
| SMILES | C=C(C1CC1)C(CCOCCCCc1ccc2c(n1)NCCC2)NC(=O)C1(n2c(Br)cccc2=O)CC1 |
| InChI | InChI=1S/C29H37BrN4O3/c1-20(21-10-11-21)24(33-28(36)29(15-16-29)34-25(30)8-4-9-26(34)35)14-19-37-18-3-2-7-23-13-12-22-6-5-17-31-27(22)32-23/h4,8-9,12-13,21,24H,1-3,5-7,10-11,14-19H2,(H,31,32)(H,33,36) |
| InChIKey | JEJIWHWMFXDGEE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|