C32H33F5N2O2 — CID 171835268
N-[(1Z,6Z)-1,7-bis(3,4-difluorophenyl)-2,6-dimethylhepta-1,6-dien-4-yl]-4-[2-(dimethylamino)ethoxy]-3-fluorobenzamide (PubChem CID 171835268) has the molecular formula C32H33F5N2O2 and a molecular weight of 572.62 g/mol. Its IUPAC name is N-[(1Z,6Z)-1,7-bis(3,4-difluorophenyl)-2,6-dimethylhepta-1,6-dien-4-yl]-4-[2-(dimethylamino)ethoxy]-3-fluorobenzamide.
| Compound Name | N-[(1Z,6Z)-1,7-bis(3,4-difluorophenyl)-2,6-dimethylhepta-1,6-dien-4-yl]-4-[2-(dimethylamino)ethoxy]-3-fluorobenzamide |
|---|---|
| PubChem CID | 171835268 |
| Molecular Formula | C32H33F5N2O2 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | N-[(1Z,6Z)-1,7-bis(3,4-difluorophenyl)-2,6-dimethylhepta-1,6-dien-4-yl]-4-[2-(dimethylamino)ethoxy]-3-fluorobenzamide |
| SMILES | C/C(=C/c1ccc(F)c(F)c1)CC(C/C(C)=C\c1ccc(F)c(F)c1)NC(=O)c1ccc(OCCN(C)C)c(F)c1 |
| InChI | InChI=1S/C32H33F5N2O2/c1-20(13-22-5-8-26(33)28(35)17-22)15-25(16-21(2)14-23-6-9-27(34)29(36)18-23)38-32(40)24-7-10-31(30(37)19-24)41-12-11-39(3)4/h5-10,13-14,17-19,25H,11-12,15-16H2,1-4H3,(H,38,40)/b20-13-,21-14- |
| InChIKey | NMDDFXWXVDFHOK-NMGXZBPKSA-N |
| XLogP | 7.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |