C21H23FN4O3 — CID 171835384
4-[2-(diethylamino)ethoxy]-N-(7-fluoro-4-oxo-3H-phthalazin-1-yl)benzamide (PubChem CID 171835384) has the molecular formula C21H23FN4O3 and a molecular weight of 398.44 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethoxy]-N-(7-fluoro-4-oxo-3H-phthalazin-1-yl)benzamide.
| Compound Name | 4-[2-(diethylamino)ethoxy]-N-(7-fluoro-4-oxo-3H-phthalazin-1-yl)benzamide |
|---|---|
| PubChem CID | 171835384 |
| Molecular Formula | C21H23FN4O3 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[2-(diethylamino)ethoxy]-N-(7-fluoro-4-oxo-3H-phthalazin-1-yl)benzamide |
| SMILES | CCN(CC)CCOc1ccc(C(=O)Nc2n[nH]c(=O)c3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C21H23FN4O3/c1-3-26(4-2)11-12-29-16-8-5-14(6-9-16)20(27)23-19-18-13-15(22)7-10-17(18)21(28)25-24-19/h5-10,13H,3-4,11-12H2,1-2H3,(H,25,28)(H,23,24,27) |
| InChIKey | UXQMUZCLUDXFMM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |