C22H38N6O — CID 171838992
butane;ethane;5-hexyl-N-(3-methoxy-1H-pyrazol-5-yl)pyrrolo[2,3-b]pyrazin-3-amine (PubChem CID 171838992) has the molecular formula C22H38N6O and a molecular weight of 402.59 g/mol. Its IUPAC name is butane;ethane;5-hexyl-N-(3-methoxy-1H-pyrazol-5-yl)pyrrolo[2,3-b]pyrazin-3-amine.
| Compound Name | butane;ethane;5-hexyl-N-(3-methoxy-1H-pyrazol-5-yl)pyrrolo[2,3-b]pyrazin-3-amine |
|---|---|
| PubChem CID | 171838992 |
| Molecular Formula | C22H38N6O |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | butane;ethane;5-hexyl-N-(3-methoxy-1H-pyrazol-5-yl)pyrrolo[2,3-b]pyrazin-3-amine |
| SMILES | CC.CCCC.CCCCCCn1ccc2ncc(Nc3cc(OC)n[nH]3)nc21 |
| InChI | InChI=1S/C16H22N6O.C4H10.C2H6/c1-3-4-5-6-8-22-9-7-12-16(22)19-14(11-17-12)18-13-10-15(23-2)21-20-13;1-3-4-2;1-2/h7,9-11H,3-6,8H2,1-2H3,(H2,18,19,20,21);3-4H2,1-2H3;1-2H3 |
| InChIKey | ZAGMTJYNSYVVRC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|