C16H26ClN3 — CID 171838959
butane;3-chloro-5-hexylpyrrolo[2,3-b]pyrazine (PubChem CID 171838959) has the molecular formula C16H26ClN3 and a molecular weight of 295.86 g/mol. Its IUPAC name is butane;3-chloro-5-hexylpyrrolo[2,3-b]pyrazine.
| Compound Name | butane;3-chloro-5-hexylpyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 171838959 |
| Molecular Formula | C16H26ClN3 |
| Molecular Weight | 295.86 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | butane;3-chloro-5-hexylpyrrolo[2,3-b]pyrazine |
| SMILES | CCCC.CCCCCCn1ccc2ncc(Cl)nc21 |
| InChI | InChI=1S/C12H16ClN3.C4H10/c1-2-3-4-5-7-16-8-6-10-12(16)15-11(13)9-14-10;1-3-4-2/h6,8-9H,2-5,7H2,1H3;3-4H2,1-2H3 |
| InChIKey | OKWBFTPIOLZKOS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.86 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|