C23H36N+ — CID 171840854
5-ethenyl-1-hexyl-2,3,3-trimethyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]pyrrol-1-ium (PubChem CID 171840854) has the molecular formula C23H36N+ and a molecular weight of 326.55 g/mol. Its IUPAC name is 5-ethenyl-1-hexyl-2,3,3-trimethyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]pyrrol-1-ium.
| Compound Name | 5-ethenyl-1-hexyl-2,3,3-trimethyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]pyrrol-1-ium |
|---|---|
| PubChem CID | 171840854 |
| Molecular Formula | C23H36N+ |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | 5-ethenyl-1-hexyl-2,3,3-trimethyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]pyrrol-1-ium |
| SMILES | C=C/C=C\C(=C(C)C)C1=C(C=C)[N+](CCCCCC)=C(C)C1(C)C |
| InChI | InChI=1S/C23H36N/c1-9-12-14-15-17-24-19(6)23(7,8)22(21(24)11-3)20(18(4)5)16-13-10-2/h10-11,13,16H,2-3,9,12,14-15,17H2,1,4-8H3/q+1/b16-13- |
| InChIKey | CSNVJLJFHUDYTQ-SSZFMOIBSA-N |
| XLogP | 6.60 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|