C33H70N2O18 — CID 171850592
N-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethyl]formamide;2-hydroxy-3-[2-hydroxy-3-(2-hydroxy-4-methylpentoxy)-3-methylpentoxy]propanoic acid;propane-1,2-diol (PubChem CID 171850592) has the molecular formula C33H70N2O18 and a molecular weight of 782.92 g/mol. Its IUPAC name is N-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethyl]formamide;2-hydroxy-3-[2-hydroxy-3-(2-hydroxy-4-methylpentoxy)-3-methylpentoxy]propanoic acid;propane-1,2-diol.
| Compound Name | N-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethyl]formamide;2-hydroxy-3-[2-hydroxy-3-(2-hydroxy-4-methylpentoxy)-3-methylpentoxy]propanoic acid;propane-1,2-diol |
|---|---|
| PubChem CID | 171850592 |
| Molecular Formula | C33H70N2O18 |
| Molecular Weight | 782.92 g/mol |
| Exact Mass | 782.46 |
| IUPAC Name | N-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethyl]formamide;2-hydroxy-3-[2-hydroxy-3-(2-hydroxy-4-methylpentoxy)-3-methylpentoxy]propanoic acid;propane-1,2-diol |
| SMILES | CC(O)CO.CCC(C)(OCC(O)CC(C)C)C(O)COCC(O)C(=O)O.O=CNCCN(CC(O)C(O)C(O)CCO)CC(O)C(O)C(O)CCO |
| InChI | InChI=1S/C15H32N2O9.C15H30O7.C3H8O2/c18-5-1-10(21)14(25)12(23)7-17(4-3-16-9-20)8-13(24)15(26)11(22)2-6-19;1-5-15(4,22-7-11(16)6-10(2)3)13(18)9-21-8-12(17)14(19)20;1-3(5)2-4/h9-15,18-19,21-26H,1-8H2,(H,16,20);10-13,16-18H,5-9H2,1-4H3,(H,19,20);3-5H,2H2,1H3 |
| InChIKey | VDACJQPOXXNSJL-UHFFFAOYSA-N |
| XLogP | -5.27 |
| TPSA | 351.09 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.92 |
| LogP ≤ 5 | -5.27 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|