C14H21N3O2 — CID 171853413
4-(2,4,4-trimethylpentan-2-yl)-2H-benzotriazole-5,6-diol (PubChem CID 171853413) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(2,4,4-trimethylpentan-2-yl)-2H-benzotriazole-5,6-diol.
| Compound Name | 4-(2,4,4-trimethylpentan-2-yl)-2H-benzotriazole-5,6-diol |
|---|---|
| PubChem CID | 171853413 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-(2,4,4-trimethylpentan-2-yl)-2H-benzotriazole-5,6-diol |
| SMILES | CC(C)(C)CC(C)(C)c1c(O)c(O)cc2n[nH]nc12 |
| InChI | InChI=1S/C14H21N3O2/c1-13(2,3)7-14(4,5)10-11-8(15-17-16-11)6-9(18)12(10)19/h6,18-19H,7H2,1-5H3,(H,15,16,17) |
| InChIKey | HNOCNJHCSMLQAX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|