C9H13N5O3 — CID 171879155
4-azido-1-(6-methoxypyridazin-3-yl)butane-1,2-diol (PubChem CID 171879155) has the molecular formula C9H13N5O3 and a molecular weight of 239.24 g/mol. Its IUPAC name is 4-azido-1-(6-methoxypyridazin-3-yl)butane-1,2-diol.
| Compound Name | 4-azido-1-(6-methoxypyridazin-3-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879155 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 4-azido-1-(6-methoxypyridazin-3-yl)butane-1,2-diol |
| SMILES | COc1ccc(C(O)C(O)CCN=[N+]=[N-])nn1 |
| InChI | InChI=1S/C9H13N5O3/c1-17-8-3-2-6(12-13-8)9(16)7(15)4-5-11-14-10/h2-3,7,9,15-16H,4-5H2,1H3 |
| InChIKey | ALJOZPLNATXTDU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|