C19H22FNO5 — CID 171888321
benzyl N-[4-(2-fluoro-6-methoxyphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888321) has the molecular formula C19H22FNO5 and a molecular weight of 363.39 g/mol. Its IUPAC name is benzyl N-[4-(2-fluoro-6-methoxyphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(2-fluoro-6-methoxyphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888321 |
| Molecular Formula | C19H22FNO5 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | benzyl N-[4-(2-fluoro-6-methoxyphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | COc1cccc(F)c1C(O)C(O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H22FNO5/c1-25-16-9-5-8-14(20)17(16)18(23)15(22)10-11-21-19(24)26-12-13-6-3-2-4-7-13/h2-9,15,18,22-23H,10-12H2,1H3,(H,21,24) |
| InChIKey | PUCKIMHTRHIEKU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |