C14H20N2O3 — CID 171890919
3-[4-[1,2-dihydroxy-4-(methylamino)butyl]phenoxy]propanenitrile (PubChem CID 171890919) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-[4-[1,2-dihydroxy-4-(methylamino)butyl]phenoxy]propanenitrile.
| Compound Name | 3-[4-[1,2-dihydroxy-4-(methylamino)butyl]phenoxy]propanenitrile |
|---|---|
| PubChem CID | 171890919 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-[4-[1,2-dihydroxy-4-(methylamino)butyl]phenoxy]propanenitrile |
| SMILES | CNCCC(O)C(O)c1ccc(OCCC#N)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-16-9-7-13(17)14(18)11-3-5-12(6-4-11)19-10-2-8-15/h3-6,13-14,16-18H,2,7,9-10H2,1H3 |
| InChIKey | RHCULGDTACAPIW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|