About 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide
4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide (PubChem CID 171899432) has the molecular formula C11H12ClNO5
and a molecular weight of 273.67 g/mol. Its IUPAC name is 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide.
Molecular Properties
| Compound Name | 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide |
| PubChem CID | 171899432 |
| Molecular Formula | C11H12ClNO5 |
| Molecular Weight | 273.67 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1cc(Cl)cc(C=O)c1O |
| InChI | InChI=1S/C11H12ClNO5/c12-6-1-5(4-14)10(17)7(2-6)11(18)8(15)3-9(13)16/h1-2,4,8,11,15,17-18H,3H2,(H2,13,16) |
| InChIKey | HMZPLGDLJSTZFO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.67 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide?
The IUPAC name of 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide (CID 171899432) is 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide.
What is the SMILES notation for 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide?
The canonical SMILES for 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide is NC(=O)CC(O)C(O)c1cc(Cl)cc(C=O)c1O.
What is the InChIKey of 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide?
The InChIKey is HMZPLGDLJSTZFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO5/c12-6-1-5(4-14)10(17)7(2-6)11(18)8(15)3-9(13)16/h1-2,4,8,11,15,17-18H,3H2,(H2,13,16).
What are the key properties of 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide?
4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide has a molecular weight of 273.67 g/mol, XLogP of 0.13, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide is sourced from PubChem (CID 171899432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).