C11H12ClNO5 — CID 171899432
4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide (PubChem CID 171899432) has the molecular formula C11H12ClNO5 and a molecular weight of 273.67 g/mol. Its IUPAC name is 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899432 |
| Molecular Formula | C11H12ClNO5 |
| Molecular Weight | 273.67 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1cc(Cl)cc(C=O)c1O |
| InChI | InChI=1S/C11H12ClNO5/c12-6-1-5(4-14)10(17)7(2-6)11(18)8(15)3-9(13)16/h1-2,4,8,11,15,17-18H,3H2,(H2,13,16) |
| InChIKey | HMZPLGDLJSTZFO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.67 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|