C12H16FNO2 — CID 171905662
N,N-diethyl-2-fluoro-4-hydroxy-6-methylbenzamide (PubChem CID 171905662) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is N,N-diethyl-2-fluoro-4-hydroxy-6-methylbenzamide.
| Compound Name | N,N-diethyl-2-fluoro-4-hydroxy-6-methylbenzamide |
|---|---|
| PubChem CID | 171905662 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N,N-diethyl-2-fluoro-4-hydroxy-6-methylbenzamide |
| SMILES | CCN(CC)C(=O)c1c(C)cc(O)cc1F |
| InChI | InChI=1S/C12H16FNO2/c1-4-14(5-2)12(16)11-8(3)6-9(15)7-10(11)13/h6-7,15H,4-5H2,1-3H3 |
| InChIKey | GNMJWDBJTDPHQO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |