C15H24O4 — CID 171905910
6-ethyl-6-(5-hydroxyhexoxy)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 171905910) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 6-ethyl-6-(5-hydroxyhexoxy)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-ethyl-6-(5-hydroxyhexoxy)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 171905910 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 6-ethyl-6-(5-hydroxyhexoxy)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCC1(OCCCCC(C)O)C=CC=CC1C(=O)O |
| InChI | InChI=1S/C15H24O4/c1-3-15(19-11-7-5-8-12(2)16)10-6-4-9-13(15)14(17)18/h4,6,9-10,12-13,16H,3,5,7-8,11H2,1-2H3,(H,17,18) |
| InChIKey | NYCHGXHJCMSIBC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|