C12H13F3INO — CID 171921541
4-iodo-N-(2-methylpropyl)-2-(trifluoromethyl)benzamide (PubChem CID 171921541) has the molecular formula C12H13F3INO and a molecular weight of 371.14 g/mol. Its IUPAC name is 4-iodo-N-(2-methylpropyl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-iodo-N-(2-methylpropyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171921541 |
| Molecular Formula | C12H13F3INO |
| Molecular Weight | 371.14 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 4-iodo-N-(2-methylpropyl)-2-(trifluoromethyl)benzamide |
| SMILES | CC(C)CNC(=O)c1ccc(I)cc1C(F)(F)F |
| InChI | InChI=1S/C12H13F3INO/c1-7(2)6-17-11(18)9-4-3-8(16)5-10(9)12(13,14)15/h3-5,7H,6H2,1-2H3,(H,17,18) |
| InChIKey | PPABROOOCDEBTJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|